C13H14ClNO5 — CID 70183599
(2S,3R,4S,5S)-2-[(6-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol (PubChem CID 70183599) has the molecular formula C13H14ClNO5 and a molecular weight of 299.71 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[(6-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[(6-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70183599 |
| Molecular Formula | C13H14ClNO5 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2S,3R,4S,5S)-2-[(6-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2c[nH]c3cc(Cl)ccc23)OC[C@@H]1O |
| InChI | InChI=1S/C13H14ClNO5/c14-6-1-2-7-8(3-6)15-4-10(7)20-13-12(18)11(17)9(16)5-19-13/h1-4,9,11-13,15-18H,5H2/t9-,11-,12+,13-/m0/s1 |
| InChIKey | OYHCMIUPCOUWHG-SYEHKZFSSA-N |
| XLogP | 0.64 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |