About 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile
2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 70183672) has the molecular formula C13H13FN4
and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 70183672 |
| Molecular Formula | C13H13FN4 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | N#CC1=C(F)C=CC/C1=N\CCCn1ccnc1 |
| InChI | InChI=1S/C13H13FN4/c14-12-3-1-4-13(11(12)9-15)17-5-2-7-18-8-6-16-10-18/h1,3,6,8,10H,2,4-5,7H2/b17-13+ |
| InChIKey | WFDDMGRGHDSDFI-GHRIWEEISA-N |
| XLogP | 2.42 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile (CID 70183672) is 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile is N#CC1=C(F)C=CC/C1=N\CCCn1ccnc1.
What is the InChIKey of 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is WFDDMGRGHDSDFI-GHRIWEEISA-N. The full InChI is InChI=1S/C13H13FN4/c14-12-3-1-4-13(11(12)9-15)17-5-2-7-18-8-6-16-10-18/h1,3,6,8,10H,2,4-5,7H2/b17-13+.
What are the key properties of 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile?
2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 244.27 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(3-imidazol-1-ylpropylimino)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 70183672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).