C24H32N2O5 — CID 70184293
(Z)-but-2-enedioic acid;8-(3-methyl-1,2-oxazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 70184293) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;8-(3-methyl-1,2-oxazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;8-(3-methyl-1,2-oxazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 70184293 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;8-(3-methyl-1,2-oxazol-5-yl)-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2cccc(-c3cc(C)no3)c2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H28N2O.C4H4O4/c1-4-11-22(12-5-2)17-10-9-16-7-6-8-18(19(16)14-17)20-13-15(3)21-23-20;5-3(6)1-2-4(7)8/h6-8,13,17H,4-5,9-12,14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FPHOEJGEJCDJQU-BTJKTKAUSA-N |
| XLogP | 4.34 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|