About 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene
1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene (PubChem CID 70185336) has the molecular formula C21H22F2
and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene.
Molecular Properties
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene |
| PubChem CID | 70185336 |
| Molecular Formula | C21H22F2 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene |
| SMILES | C/C=C\c1ccc(-c2ccc(C3CCC(F)(F)CC3)cc2)cc1 |
| InChI | InChI=1S/C21H22F2/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(22,23)15-13-20/h2-11,20H,12-15H2,1H3/b3-2- |
| InChIKey | QVCQECHENDMDJG-IHWYPQMZSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene?
The IUPAC name of 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene (CID 70185336) is 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene is C/C=C\c1ccc(-c2ccc(C3CCC(F)(F)CC3)cc2)cc1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene?
The InChIKey is QVCQECHENDMDJG-IHWYPQMZSA-N. The full InChI is InChI=1S/C21H22F2/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(22,23)15-13-20/h2-11,20H,12-15H2,1H3/b3-2-.
What are the key properties of 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene?
1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene has a molecular weight of 312.40 g/mol, XLogP of 6.68, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)-4-[4-[(Z)-prop-1-enyl]phenyl]benzene is sourced from PubChem (CID 70185336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).