C15H26F3NO2 — CID 70185374
2-[2,4-dimethyl-6-[(4,4,4-trifluorobutylamino)methyl]cyclohexyl]acetic acid (PubChem CID 70185374) has the molecular formula C15H26F3NO2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[2,4-dimethyl-6-[(4,4,4-trifluorobutylamino)methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[2,4-dimethyl-6-[(4,4,4-trifluorobutylamino)methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 70185374 |
| Molecular Formula | C15H26F3NO2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[2,4-dimethyl-6-[(4,4,4-trifluorobutylamino)methyl]cyclohexyl]acetic acid |
| SMILES | CC1CC(C)C(CC(=O)O)C(CNCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C15H26F3NO2/c1-10-6-11(2)13(8-14(20)21)12(7-10)9-19-5-3-4-15(16,17)18/h10-13,19H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | FGUMODOZZAHSIQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|