C16H24O4 — CID 70185513
6-hexanoyloxy-2,4,4-trimethylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 70185513) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 6-hexanoyloxy-2,4,4-trimethylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 6-hexanoyloxy-2,4,4-trimethylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70185513 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 6-hexanoyloxy-2,4,4-trimethylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CCCCCC(=O)OC1=CC(C)(C)CC(C)=C1C(=O)O |
| InChI | InChI=1S/C16H24O4/c1-5-6-7-8-13(17)20-12-10-16(3,4)9-11(2)14(12)15(18)19/h10H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | PHMJSZLLPVJMOJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|