C33H42N2O5S — CID 70186026
(2S)-N-(3,4-dimethoxyphenyl)sulfonyl-N-(1,7-diphenylheptan-4-yl)piperidine-2-carboxamide (PubChem CID 70186026) has the molecular formula C33H42N2O5S and a molecular weight of 578.78 g/mol. Its IUPAC name is (2S)-N-(3,4-dimethoxyphenyl)sulfonyl-N-(1,7-diphenylheptan-4-yl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(3,4-dimethoxyphenyl)sulfonyl-N-(1,7-diphenylheptan-4-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 70186026 |
| Molecular Formula | C33H42N2O5S |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | (2S)-N-(3,4-dimethoxyphenyl)sulfonyl-N-(1,7-diphenylheptan-4-yl)piperidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(C(=O)[C@@H]2CCCCN2)C(CCCc2ccccc2)CCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C33H42N2O5S/c1-39-31-23-22-29(25-32(31)40-2)41(37,38)35(33(36)30-21-9-10-24-34-30)28(19-11-17-26-13-5-3-6-14-26)20-12-18-27-15-7-4-8-16-27/h3-8,13-16,22-23,25,28,30,34H,9-12,17-21,24H2,1-2H3/t30-/m0/s1 |
| InChIKey | MHEGRDUZSXUZPB-PMERELPUSA-N |
| XLogP | 5.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |