C21H28N2O6 — CID 70186230
4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2,3-diethylbut-2-enedioic acid (PubChem CID 70186230) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is 4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2,3-diethylbut-2-enedioic acid.
| Compound Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2,3-diethylbut-2-enedioic acid |
|---|---|
| PubChem CID | 70186230 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-butyl-1-phenylpyrazolidine-3,5-dione;(Z)-2,3-diethylbut-2-enedioic acid |
| SMILES | CC/C(C(=O)O)=C(\CC)C(=O)O.CCCCC1C(=O)NN(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H16N2O2.C8H12O4/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;1-3-5(7(9)10)6(4-2)8(11)12/h4-8,11H,2-3,9H2,1H3,(H,14,16);3-4H2,1-2H3,(H,9,10)(H,11,12)/b;6-5- |
| InChIKey | JMUKKTMKNBZMHX-JXGYXAOLSA-N |
| XLogP | 3.14 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|