C12H20N2 — CID 70186702
5,5,8,8-tetramethyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 70186702) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5,5,8,8-tetramethyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 5,5,8,8-tetramethyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 70186702 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5,5,8,8-tetramethyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | CC1(C)C=CC(C)(C)C2=C1NCCN2 |
| InChI | InChI=1S/C12H20N2/c1-11(2)5-6-12(3,4)10-9(11)13-7-8-14-10/h5-6,13-14H,7-8H2,1-4H3 |
| InChIKey | SKEGCNUFOHZUIL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|