C11H12N4 — CID 70186991
2-N-methyl-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 70186991) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-N-methyl-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 70186991 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-N-methyl-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | CNc1nccc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4/c1-12-11-13-8-7-10(15-11)14-9-5-3-2-4-6-9/h2-8H,1H3,(H2,12,13,14,15) |
| InChIKey | IUAIFJHCTFVMIX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |