C18H28O3 — CID 70187088
(5S)-5-[(2R)-2-[(1R,7R)-4-hydroxy-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one (PubChem CID 70187088) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (5S)-5-[(2R)-2-[(1R,7R)-4-hydroxy-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one.
| Compound Name | (5S)-5-[(2R)-2-[(1R,7R)-4-hydroxy-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 70187088 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (5S)-5-[(2R)-2-[(1R,7R)-4-hydroxy-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]propyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1C[C@H](C[C@@H](C)[C@H]2CCC3C(O)CCC(C)C32)OC1=O |
| InChI | InChI=1S/C18H28O3/c1-10-4-7-16(19)15-6-5-14(17(10)15)11(2)8-13-9-12(3)18(20)21-13/h10-11,13-17,19H,3-9H2,1-2H3/t10?,11-,13+,14-,15?,16?,17?/m1/s1 |
| InChIKey | WHLOBPXJYKHKCW-VWSGOGLISA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|