About (2-oxoazepan-1-yl) 6-aminohexanoate
(2-oxoazepan-1-yl) 6-aminohexanoate (PubChem CID 70187380) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is (2-oxoazepan-1-yl) 6-aminohexanoate.
Molecular Properties
| Compound Name | (2-oxoazepan-1-yl) 6-aminohexanoate |
| PubChem CID | 70187380 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (2-oxoazepan-1-yl) 6-aminohexanoate |
| SMILES | NCCCCCC(=O)ON1CCCCCC1=O |
| InChI | InChI=1S/C12H22N2O3/c13-9-5-1-4-8-12(16)17-14-10-6-2-3-7-11(14)15/h1-10,13H2 |
| InChIKey | VROTXRAOZJEECV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-oxoazepan-1-yl) 6-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-1-yl) 6-aminohexanoate?
The IUPAC name of (2-oxoazepan-1-yl) 6-aminohexanoate (CID 70187380) is (2-oxoazepan-1-yl) 6-aminohexanoate.
What is the SMILES notation for (2-oxoazepan-1-yl) 6-aminohexanoate?
The canonical SMILES for (2-oxoazepan-1-yl) 6-aminohexanoate is NCCCCCC(=O)ON1CCCCCC1=O.
What is the InChIKey of (2-oxoazepan-1-yl) 6-aminohexanoate?
The InChIKey is VROTXRAOZJEECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c13-9-5-1-4-8-12(16)17-14-10-6-2-3-7-11(14)15/h1-10,13H2.
What are the key properties of (2-oxoazepan-1-yl) 6-aminohexanoate?
(2-oxoazepan-1-yl) 6-aminohexanoate has a molecular weight of 242.32 g/mol, XLogP of 1.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-1-yl) 6-aminohexanoate is sourced from PubChem (CID 70187380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).