About CID 70187771
CID 70187771 (PubChem CID 70187771) has the molecular formula C41H42NO4Si
and a molecular weight of 640.88 g/mol.
Molecular Properties
| Compound Name | CID 70187771 |
| PubChem CID | 70187771 |
| Molecular Formula | C41H42NO4Si |
| Molecular Weight | 640.88 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cccc2c1CCC(O[Si](c1ccccc1)c1ccccc1)C2(O)CCOC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H42NO4Si/c1-40(2,3)36-25-16-26-37-35(36)27-28-38(46-47(33-21-12-6-13-22-33)34-23-14-7-15-24-34)41(37,44)29-30-45-39(43)42(31-17-8-4-9-18-31)32-19-10-5-11-20-32/h4-26,38,44H,27-30H2,1-3H3 |
| InChIKey | MBRZZEGQIRLKGT-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.88 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70187771 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70187771?
The IUPAC name of CID 70187771 (CID 70187771) is not available.
What is the SMILES notation for CID 70187771?
The canonical SMILES for CID 70187771 is CC(C)(C)c1cccc2c1CCC(O[Si](c1ccccc1)c1ccccc1)C2(O)CCOC(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 70187771?
The InChIKey is MBRZZEGQIRLKGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H42NO4Si/c1-40(2,3)36-25-16-26-37-35(36)27-28-38(46-47(33-21-12-6-13-22-33)34-23-14-7-15-24-34)41(37,44)29-30-45-39(43)42(31-17-8-4-9-18-31)32-19-10-5-11-20-32/h4-26,38,44H,27-30H2,1-3H3.
What are the key properties of CID 70187771?
CID 70187771 has a molecular weight of 640.88 g/mol, XLogP of 7.67, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70187771 is sourced from PubChem (CID 70187771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).