About 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole
5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole (PubChem CID 70187994) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole |
| PubChem CID | 70187994 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole |
| SMILES | C[C@H](/C=C\CCC1CCCCC1)C1(c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C18H28N2/c1-15(18(11-12-18)17-13-19-14-20-17)7-5-6-10-16-8-3-2-4-9-16/h5,7,13-16H,2-4,6,8-12H2,1H3,(H,19,20)/b7-5-/t15-/m1/s1 |
| InChIKey | RFRYDMNKSRABGP-ZQMJAJRESA-N |
| XLogP | 4.99 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole?
The IUPAC name of 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole (CID 70187994) is 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole.
What is the SMILES notation for 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole?
The canonical SMILES for 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole is C[C@H](/C=C\CCC1CCCCC1)C1(c2cnc[nH]2)CC1.
What is the InChIKey of 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole?
The InChIKey is RFRYDMNKSRABGP-ZQMJAJRESA-N. The full InChI is InChI=1S/C18H28N2/c1-15(18(11-12-18)17-13-19-14-20-17)7-5-6-10-16-8-3-2-4-9-16/h5,7,13-16H,2-4,6,8-12H2,1H3,(H,19,20)/b7-5-/t15-/m1/s1.
What are the key properties of 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole?
5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole has a molecular weight of 272.44 g/mol, XLogP of 4.99, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(Z,2R)-6-cyclohexylhex-3-en-2-yl]cyclopropyl]-1H-imidazole is sourced from PubChem (CID 70187994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).