C20H24O6 — CID 70189046
(2R,3S,4R,5S,6S)-3-benzyl-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol (PubChem CID 70189046) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-3-benzyl-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-3-benzyl-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 70189046 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2R,3S,4R,5S,6S)-3-benzyl-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](OCc2ccccc2)[C@@H](O)[C@@H](O)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H24O6/c21-12-16-20(24,11-14-7-3-1-4-8-14)18(23)17(22)19(26-16)25-13-15-9-5-2-6-10-15/h1-10,16-19,21-24H,11-13H2/t16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | ZKWGHUZBTCUVJZ-UJMXGEILSA-N |
| XLogP | 0.62 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |