C26H21F3O2S2 — CID 70189058
1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate;sulfane (PubChem CID 70189058) has the molecular formula C26H21F3O2S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate;sulfane.
| Compound Name | 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate;sulfane |
|---|---|
| PubChem CID | 70189058 |
| Molecular Formula | C26H21F3O2S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 1,1'-biphenyl;(4-phenylsulfanylphenyl) 2,2,2-trifluoroacetate;sulfane |
| SMILES | O=C(Oc1ccc(Sc2ccccc2)cc1)C(F)(F)F.S.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H9F3O2S.C12H10.H2S/c15-14(16,17)13(18)19-10-6-8-12(9-7-10)20-11-4-2-1-3-5-11;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-9H;1-10H;1H2 |
| InChIKey | SQYJPVBUHRJPNK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|