About 3-phenoxythiophene
3-phenoxythiophene (PubChem CID 7018947) has the molecular formula C10H8OS
and a molecular weight of 176.24 g/mol. Its IUPAC name is 3-phenoxythiophene.
Molecular Properties
| Compound Name | 3-phenoxythiophene |
| PubChem CID | 7018947 |
| Molecular Formula | C10H8OS |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 3-phenoxythiophene |
| SMILES | c1ccc(Oc2ccsc2)cc1 |
| InChI | InChI=1S/C10H8OS/c1-2-4-9(5-3-1)11-10-6-7-12-8-10/h1-8H |
| InChIKey | DXSHUWUDKNEGFS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxythiophene?
The IUPAC name of 3-phenoxythiophene (CID 7018947) is 3-phenoxythiophene.
What is the SMILES notation for 3-phenoxythiophene?
The canonical SMILES for 3-phenoxythiophene is c1ccc(Oc2ccsc2)cc1.
What is the InChIKey of 3-phenoxythiophene?
The InChIKey is DXSHUWUDKNEGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8OS/c1-2-4-9(5-3-1)11-10-6-7-12-8-10/h1-8H.
What are the key properties of 3-phenoxythiophene?
3-phenoxythiophene has a molecular weight of 176.24 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxythiophene is sourced from PubChem (CID 7018947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).