About (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate
(2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate (PubChem CID 70189652) has the molecular formula C22H16F3NO3
and a molecular weight of 399.37 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate.
Molecular Properties
| Compound Name | (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate |
| PubChem CID | 70189652 |
| Molecular Formula | C22H16F3NO3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate |
| SMILES | COc1ccc2c(c1)C(C(=O)Oc1c(F)ccc(F)c1F)c1ccccc1N2C |
| InChI | InChI=1S/C22H16F3NO3/c1-26-17-6-4-3-5-13(17)19(14-11-12(28-2)7-10-18(14)26)22(27)29-21-16(24)9-8-15(23)20(21)25/h3-11,19H,1-2H3 |
| InChIKey | VOIGOZVLBHGVAC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate?
The IUPAC name of (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate (CID 70189652) is (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate.
What is the SMILES notation for (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate?
The canonical SMILES for (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate is COc1ccc2c(c1)C(C(=O)Oc1c(F)ccc(F)c1F)c1ccccc1N2C.
What is the InChIKey of (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate?
The InChIKey is VOIGOZVLBHGVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F3NO3/c1-26-17-6-4-3-5-13(17)19(14-11-12(28-2)7-10-18(14)26)22(27)29-21-16(24)9-8-15(23)20(21)25/h3-11,19H,1-2H3.
What are the key properties of (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate?
(2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate has a molecular weight of 399.37 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,6-trifluorophenyl) 2-methoxy-10-methyl-9H-acridine-9-carboxylate is sourced from PubChem (CID 70189652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).