C17H22N2O7 — CID 70190338
2-benzoyl-3-[(3R,4R)-3,4-diaminocyclohexyl]oxy-2-hydroxybutanedioic acid (PubChem CID 70190338) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-benzoyl-3-[(3R,4R)-3,4-diaminocyclohexyl]oxy-2-hydroxybutanedioic acid.
| Compound Name | 2-benzoyl-3-[(3R,4R)-3,4-diaminocyclohexyl]oxy-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 70190338 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-benzoyl-3-[(3R,4R)-3,4-diaminocyclohexyl]oxy-2-hydroxybutanedioic acid |
| SMILES | N[C@@H]1CCC(OC(C(=O)O)C(O)(C(=O)O)C(=O)c2ccccc2)C[C@H]1N |
| InChI | InChI=1S/C17H22N2O7/c18-11-7-6-10(8-12(11)19)26-14(15(21)22)17(25,16(23)24)13(20)9-4-2-1-3-5-9/h1-5,10-12,14,25H,6-8,18-19H2,(H,21,22)(H,23,24)/t10?,11-,12-,14?,17?/m1/s1 |
| InChIKey | FWACHPWNLSMRGK-QWLYZJRRSA-N |
| XLogP | -0.64 |
| TPSA | 173.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|