About 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone
1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone (PubChem CID 701904) has the molecular formula C11H11Cl2N3O
and a molecular weight of 272.13 g/mol. Its IUPAC name is 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone |
| PubChem CID | 701904 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone |
| SMILES | CC(=O)N1CCN=C1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O/c1-7(17)16-6-5-14-11(16)15-10-8(12)3-2-4-9(10)13/h2-4H,5-6H2,1H3,(H,14,15) |
| InChIKey | AFINVMDZLRAKEV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone?
The IUPAC name of 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone (CID 701904) is 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone.
What is the SMILES notation for 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone?
The canonical SMILES for 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone is CC(=O)N1CCN=C1Nc1c(Cl)cccc1Cl.
What is the InChIKey of 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone?
The InChIKey is AFINVMDZLRAKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3O/c1-7(17)16-6-5-14-11(16)15-10-8(12)3-2-4-9(10)13/h2-4H,5-6H2,1H3,(H,14,15).
What are the key properties of 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone?
1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone has a molecular weight of 272.13 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]ethanone is sourced from PubChem (CID 701904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).