C33H40F4N2O3 — CID 70190590
[(2R)-1,1,1-trifluorooctan-2-yl] 4-[5-[4-(2-fluorooctoxy)phenyl]pyrimidin-2-yl]benzoate (PubChem CID 70190590) has the molecular formula C33H40F4N2O3 and a molecular weight of 588.69 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 4-[5-[4-(2-fluorooctoxy)phenyl]pyrimidin-2-yl]benzoate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 4-[5-[4-(2-fluorooctoxy)phenyl]pyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 70190590 |
| Molecular Formula | C33H40F4N2O3 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 4-[5-[4-(2-fluorooctoxy)phenyl]pyrimidin-2-yl]benzoate |
| SMILES | CCCCCCC(F)COc1ccc(-c2cnc(-c3ccc(C(=O)O[C@H](CCCCCC)C(F)(F)F)cc3)nc2)cc1 |
| InChI | InChI=1S/C33H40F4N2O3/c1-3-5-7-9-11-28(34)23-41-29-19-17-24(18-20-29)27-21-38-31(39-22-27)25-13-15-26(16-14-25)32(40)42-30(33(35,36)37)12-10-8-6-4-2/h13-22,28,30H,3-12,23H2,1-2H3/t28?,30-/m1/s1 |
| InChIKey | TUJULOSQAFXQDW-FUJFQHJFSA-N |
| XLogP | 9.56 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|