About 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide
4-fluoro-N,5-dimethylcyclohexene-1-carboxamide (PubChem CID 70191204) has the molecular formula C9H14FNO
and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide.
Molecular Properties
| Compound Name | 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide |
| PubChem CID | 70191204 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide |
| SMILES | CNC(=O)C1=CCC(F)C(C)C1 |
| InChI | InChI=1S/C9H14FNO/c1-6-5-7(9(12)11-2)3-4-8(6)10/h3,6,8H,4-5H2,1-2H3,(H,11,12) |
| InChIKey | FXOONLDPBQZGOD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide?
The IUPAC name of 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide (CID 70191204) is 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide.
What is the SMILES notation for 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide?
The canonical SMILES for 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide is CNC(=O)C1=CCC(F)C(C)C1.
What is the InChIKey of 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide?
The InChIKey is FXOONLDPBQZGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO/c1-6-5-7(9(12)11-2)3-4-8(6)10/h3,6,8H,4-5H2,1-2H3,(H,11,12).
What are the key properties of 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide?
4-fluoro-N,5-dimethylcyclohexene-1-carboxamide has a molecular weight of 171.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,5-dimethylcyclohexene-1-carboxamide is sourced from PubChem (CID 70191204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).