About 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one
5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one (PubChem CID 70191226) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one |
| PubChem CID | 70191226 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one |
| SMILES | CCN1CC(CC2=CCCC=C2)OC1=O |
| InChI | InChI=1S/C12H17NO2/c1-2-13-9-11(15-12(13)14)8-10-6-4-3-5-7-10/h4,6-7,11H,2-3,5,8-9H2,1H3 |
| InChIKey | QQCLYRMLJHGLOQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one?
The IUPAC name of 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one (CID 70191226) is 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one is CCN1CC(CC2=CCCC=C2)OC1=O.
What is the InChIKey of 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one?
The InChIKey is QQCLYRMLJHGLOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-2-13-9-11(15-12(13)14)8-10-6-4-3-5-7-10/h4,6-7,11H,2-3,5,8-9H2,1H3.
What are the key properties of 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one?
5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one has a molecular weight of 207.27 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexa-1,5-dien-1-ylmethyl)-3-ethyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 70191226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).