C23H25IO4 — CID 70191411
4-iodo-3-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoic acid (PubChem CID 70191411) has the molecular formula C23H25IO4 and a molecular weight of 492.35 g/mol. Its IUPAC name is 4-iodo-3-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoic acid.
| Compound Name | 4-iodo-3-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 70191411 |
| Molecular Formula | C23H25IO4 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 4-iodo-3-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)COc3cc(C(=O)O)ccc3I)ccc21 |
| InChI | InChI=1S/C23H25IO4/c1-22(2)9-10-23(3,4)17-11-14(5-7-16(17)22)19(25)13-28-20-12-15(21(26)27)6-8-18(20)24/h5-8,11-12H,9-10,13H2,1-4H3,(H,26,27) |
| InChIKey | NOPMWHIBOHPFMP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|