C22H28INO3 — CID 70191549
2-[5-methoxy-2-(2-propan-2-yloxyphenyl)phenyl]-3,4,4-trimethyl-5H-1,3-oxazol-3-ium iodide (PubChem CID 70191549) has the molecular formula C22H28INO3 and a molecular weight of 481.37 g/mol. Its IUPAC name is 2-[5-methoxy-2-(2-propan-2-yloxyphenyl)phenyl]-3,4,4-trimethyl-5H-1,3-oxazol-3-ium iodide.
| Compound Name | 2-[5-methoxy-2-(2-propan-2-yloxyphenyl)phenyl]-3,4,4-trimethyl-5H-1,3-oxazol-3-ium iodide |
|---|---|
| PubChem CID | 70191549 |
| Molecular Formula | C22H28INO3 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-[5-methoxy-2-(2-propan-2-yloxyphenyl)phenyl]-3,4,4-trimethyl-5H-1,3-oxazol-3-ium iodide |
| SMILES | COc1ccc(-c2ccccc2OC(C)C)c(C2=[N+](C)C(C)(C)CO2)c1.[I-] |
| InChI | InChI=1S/C22H28NO3.HI/c1-15(2)26-20-10-8-7-9-18(20)17-12-11-16(24-6)13-19(17)21-23(5)22(3,4)14-25-21;/h7-13,15H,14H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | MNJVIIINKYCGQK-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|