C21H21NO4 — CID 70191601
(3R,7S,8R,12R)-4-methyl-13-oxa-4-azahexacyclo[12.7.1.03,8.07,12.07,22.016,21]docosa-1(22),9,14,16,18,20-hexaene-11,11,15-triol (PubChem CID 70191601) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (3R,7S,8R,12R)-4-methyl-13-oxa-4-azahexacyclo[12.7.1.03,8.07,12.07,22.016,21]docosa-1(22),9,14,16,18,20-hexaene-11,11,15-triol.
| Compound Name | (3R,7S,8R,12R)-4-methyl-13-oxa-4-azahexacyclo[12.7.1.03,8.07,12.07,22.016,21]docosa-1(22),9,14,16,18,20-hexaene-11,11,15-triol |
|---|---|
| PubChem CID | 70191601 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (3R,7S,8R,12R)-4-methyl-13-oxa-4-azahexacyclo[12.7.1.03,8.07,12.07,22.016,21]docosa-1(22),9,14,16,18,20-hexaene-11,11,15-triol |
| SMILES | CN1CC[C@@]23c4c5c(O)c6ccccc6c4C[C@@H]1[C@@H]2C=CC(O)(O)[C@@H]3O5 |
| InChI | InChI=1S/C21H21NO4/c1-22-9-8-20-14-6-7-21(24,25)19(20)26-18-16(20)13(10-15(14)22)11-4-2-3-5-12(11)17(18)23/h2-7,14-15,19,23-25H,8-10H2,1H3/t14-,15+,19+,20-/m0/s1 |
| InChIKey | LNJRRJQUAXINPL-BWMZKYQQSA-N |
| XLogP | 1.67 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|