About (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one
(5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one (PubChem CID 70193166) has the molecular formula C17H12ClF3N2O2
and a molecular weight of 368.74 g/mol. Its IUPAC name is (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one.
Molecular Properties
| Compound Name | (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one |
| PubChem CID | 70193166 |
| Molecular Formula | C17H12ClF3N2O2 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one |
| SMILES | Cc1cccc(O[C@]2(C(F)(F)F)C=NC(=O)Nc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C17H12ClF3N2O2/c1-10-3-2-4-12(7-10)25-16(17(19,20)21)9-22-15(24)23-14-6-5-11(18)8-13(14)16/h2-9H,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | SAKCBSLNWYJLBL-MRXNPFEDSA-N |
| XLogP | 5.10 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
The IUPAC name of (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one (CID 70193166) is (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one.
What is the SMILES notation for (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
The canonical SMILES for (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one is Cc1cccc(O[C@]2(C(F)(F)F)C=NC(=O)Nc3ccc(Cl)cc32)c1.
What is the InChIKey of (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
The InChIKey is SAKCBSLNWYJLBL-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H12ClF3N2O2/c1-10-3-2-4-12(7-10)25-16(17(19,20)21)9-22-15(24)23-14-6-5-11(18)8-13(14)16/h2-9H,1H3,(H,23,24)/t16-/m1/s1.
What are the key properties of (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
(5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one has a molecular weight of 368.74 g/mol, XLogP of 5.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-chloro-5-(3-methylphenoxy)-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one is sourced from PubChem (CID 70193166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).