C10H18O4S — CID 70193180
(3aR,6S,6aS)-4-methoxy-2,2-dimethyl-6-(methylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 70193180) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is (3aR,6S,6aS)-4-methoxy-2,2-dimethyl-6-(methylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,6S,6aS)-4-methoxy-2,2-dimethyl-6-(methylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 70193180 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3aR,6S,6aS)-4-methoxy-2,2-dimethyl-6-(methylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | COC1O[C@H](CSC)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H18O4S/c1-10(2)13-7-6(5-15-4)12-9(11-3)8(7)14-10/h6-9H,5H2,1-4H3/t6-,7-,8-,9?/m1/s1 |
| InChIKey | IXWUUWCPCFGJLU-BYBOBHAWSA-N |
| XLogP | 1.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |