About 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one
3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one (PubChem CID 70193222) has the molecular formula C23H25N3O2
and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one.
Molecular Properties
| Compound Name | 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one |
| PubChem CID | 70193222 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one |
| SMILES | CC1(C)c2cc(OC3CCNCC3)ccc2C(=O)c2c1[nH]c1cc(N)ccc21 |
| InChI | InChI=1S/C23H25N3O2/c1-23(2)18-12-15(28-14-7-9-25-10-8-14)4-6-16(18)21(27)20-17-5-3-13(24)11-19(17)26-22(20)23/h3-6,11-12,14,25-26H,7-10,24H2,1-2H3 |
| InChIKey | MIBZMSSZHCUJAQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one?
The IUPAC name of 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one (CID 70193222) is 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one.
What is the SMILES notation for 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one?
The canonical SMILES for 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one is CC1(C)c2cc(OC3CCNCC3)ccc2C(=O)c2c1[nH]c1cc(N)ccc21.
What is the InChIKey of 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one?
The InChIKey is MIBZMSSZHCUJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2/c1-23(2)18-12-15(28-14-7-9-25-10-8-14)4-6-16(18)21(27)20-17-5-3-13(24)11-19(17)26-22(20)23/h3-6,11-12,14,25-26H,7-10,24H2,1-2H3.
What are the key properties of 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one?
3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one has a molecular weight of 375.47 g/mol, XLogP of 3.75, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,6-dimethyl-8-piperidin-4-yloxy-5H-benzo[b]carbazol-11-one is sourced from PubChem (CID 70193222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).