C22H30F3N3 — CID 70193592
N-ethyl-1,5-dimethyl-N-(2,2,2-trifluoroethyl)-4-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)-2H-pyrrolo[3,2-b]pyridin-7-amine (PubChem CID 70193592) has the molecular formula C22H30F3N3 and a molecular weight of 393.50 g/mol. Its IUPAC name is N-ethyl-1,5-dimethyl-N-(2,2,2-trifluoroethyl)-4-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)-2H-pyrrolo[3,2-b]pyridin-7-amine.
| Compound Name | N-ethyl-1,5-dimethyl-N-(2,2,2-trifluoroethyl)-4-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)-2H-pyrrolo[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 70193592 |
| Molecular Formula | C22H30F3N3 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-ethyl-1,5-dimethyl-N-(2,2,2-trifluoroethyl)-4-(1,4,6-trimethylcyclohexa-2,4-dien-1-yl)-2H-pyrrolo[3,2-b]pyridin-7-amine |
| SMILES | CCN(CC(F)(F)F)C1=C2C(=CCN2C)N(C2(C)C=CC(C)=CC2C)C(C)=C1 |
| InChI | InChI=1S/C22H30F3N3/c1-7-27(14-22(23,24)25)19-13-17(4)28(18-9-11-26(6)20(18)19)21(5)10-8-15(2)12-16(21)3/h8-10,12-13,16H,7,11,14H2,1-6H3 |
| InChIKey | MWXAZKCCXNPUGY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |