About 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid
3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid (PubChem CID 70193767) has the molecular formula C19H16N2O3
and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid |
| PubChem CID | 70193767 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid |
| SMILES | CC1(C)c2cc(C(=O)O)ccc2C(=O)c2c1[nH]c1cc(N)ccc21 |
| InChI | InChI=1S/C19H16N2O3/c1-19(2)13-7-9(18(23)24)3-5-11(13)16(22)15-12-6-4-10(20)8-14(12)21-17(15)19/h3-8,21H,20H2,1-2H3,(H,23,24) |
| InChIKey | LOFCLGRVVYFVKN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid?
The IUPAC name of 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid (CID 70193767) is 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid.
What is the SMILES notation for 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid?
The canonical SMILES for 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid is CC1(C)c2cc(C(=O)O)ccc2C(=O)c2c1[nH]c1cc(N)ccc21.
What is the InChIKey of 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid?
The InChIKey is LOFCLGRVVYFVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3/c1-19(2)13-7-9(18(23)24)3-5-11(13)16(22)15-12-6-4-10(20)8-14(12)21-17(15)19/h3-8,21H,20H2,1-2H3,(H,23,24).
What are the key properties of 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid?
3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid has a molecular weight of 320.35 g/mol, XLogP of 3.32, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxylic acid is sourced from PubChem (CID 70193767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).