About 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol
3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol (PubChem CID 70193997) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol |
| PubChem CID | 70193997 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol |
| SMILES | Nc1cc(CC(O)CO)cc(-c2cccs2)c1N |
| InChI | InChI=1S/C13H16N2O2S/c14-11-6-8(4-9(17)7-16)5-10(13(11)15)12-2-1-3-18-12/h1-3,5-6,9,16-17H,4,7,14-15H2 |
| InChIKey | HUKSSBBZNJBSBA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol?
The IUPAC name of 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol (CID 70193997) is 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol.
What is the SMILES notation for 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol?
The canonical SMILES for 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol is Nc1cc(CC(O)CO)cc(-c2cccs2)c1N.
What is the InChIKey of 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol?
The InChIKey is HUKSSBBZNJBSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c14-11-6-8(4-9(17)7-16)5-10(13(11)15)12-2-1-3-18-12/h1-3,5-6,9,16-17H,4,7,14-15H2.
What are the key properties of 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol?
3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol has a molecular weight of 264.35 g/mol, XLogP of 1.48, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-diamino-5-thiophen-2-ylphenyl)propane-1,2-diol is sourced from PubChem (CID 70193997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).