C25H23F3O5 — CID 70194205
ethyl 2-(2-hydroxyethoxy)-3-(4-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]benzoate (PubChem CID 70194205) has the molecular formula C25H23F3O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is ethyl 2-(2-hydroxyethoxy)-3-(4-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]benzoate.
| Compound Name | ethyl 2-(2-hydroxyethoxy)-3-(4-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 70194205 |
| Molecular Formula | C25H23F3O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | ethyl 2-(2-hydroxyethoxy)-3-(4-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2cccc(C(F)(F)F)c2)cc(-c2ccc(OC)cc2)c1OCCO |
| InChI | InChI=1S/C25H23F3O5/c1-3-32-24(30)22-15-18(17-5-4-6-19(13-17)25(26,27)28)14-21(23(22)33-12-11-29)16-7-9-20(31-2)10-8-16/h4-10,13-15,29H,3,11-12H2,1-2H3 |
| InChIKey | DWXNQWVRIWQGIR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |