C7H15F2N2O3+ — CID 7019452
[2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium (PubChem CID 7019452) has the molecular formula C7H15F2N2O3+ and a molecular weight of 213.20 g/mol. Its IUPAC name is [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium.
| Compound Name | [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 7019452 |
| Molecular Formula | C7H15F2N2O3+ |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium |
| SMILES | O=C(NCCO)C(F)(F)C[NH2+]CCO |
| InChI | InChI=1S/C7H14F2N2O3/c8-7(9,5-10-1-3-12)6(14)11-2-4-13/h10,12-13H,1-5H2,(H,11,14)/p+1 |
| InChIKey | JMVFHRLIJGUDEU-UHFFFAOYSA-O |
| XLogP | -2.71 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|