About [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium
[2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium (PubChem CID 7019452) has the molecular formula C7H15F2N2O3+
and a molecular weight of 213.20 g/mol. Its IUPAC name is [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium |
| PubChem CID | 7019452 |
| Molecular Formula | C7H15F2N2O3+ |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium |
| SMILES | O=C(NCCO)C(F)(F)C[NH2+]CCO |
| InChI | InChI=1S/C7H14F2N2O3/c8-7(9,5-10-1-3-12)6(14)11-2-4-13/h10,12-13H,1-5H2,(H,11,14)/p+1 |
| InChIKey | JMVFHRLIJGUDEU-UHFFFAOYSA-O |
| XLogP | -2.71 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium?
The IUPAC name of [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium (CID 7019452) is [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium.
What is the SMILES notation for [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium?
The canonical SMILES for [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium is O=C(NCCO)C(F)(F)C[NH2+]CCO.
What is the InChIKey of [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium?
The InChIKey is JMVFHRLIJGUDEU-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H14F2N2O3/c8-7(9,5-10-1-3-12)6(14)11-2-4-13/h10,12-13H,1-5H2,(H,11,14)/p+1.
What are the key properties of [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium?
[2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium has a molecular weight of 213.20 g/mol, XLogP of -2.71, 7 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-3-(2-hydroxyethylamino)-3-oxopropyl]-(2-hydroxyethyl)azanium is sourced from PubChem (CID 7019452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).