About 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one
3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one (PubChem CID 70194627) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one.
Molecular Properties
| Compound Name | 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one |
| PubChem CID | 70194627 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one |
| SMILES | COc1ccc2c(c1)C(C)(C)c1[nH]c3c(N)c(N)ccc3c1C2=O |
| InChI | InChI=1S/C19H19N3O2/c1-19(2)12-8-9(24-3)4-5-10(12)17(23)14-11-6-7-13(20)15(21)16(11)22-18(14)19/h4-8,22H,20-21H2,1-3H3 |
| InChIKey | FPZGBTASTZURBQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
The IUPAC name of 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one (CID 70194627) is 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one.
What is the SMILES notation for 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
The canonical SMILES for 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one is COc1ccc2c(c1)C(C)(C)c1[nH]c3c(N)c(N)ccc3c1C2=O.
What is the InChIKey of 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
The InChIKey is FPZGBTASTZURBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2/c1-19(2)12-8-9(24-3)4-5-10(12)17(23)14-11-6-7-13(20)15(21)16(11)22-18(14)19/h4-8,22H,20-21H2,1-3H3.
What are the key properties of 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one has a molecular weight of 321.38 g/mol, XLogP of 3.21, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazol-11-one is sourced from PubChem (CID 70194627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).