About [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride
[3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride (PubChem CID 70194628) has the molecular formula C16H14Cl3N3
and a molecular weight of 354.67 g/mol. Its IUPAC name is [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride |
| PubChem CID | 70194628 |
| Molecular Formula | C16H14Cl3N3 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cccc(-c2ncc(-c3ccc(Cl)c(Cl)c3)[nH]2)c1 |
| InChI | InChI=1S/C16H13Cl2N3.ClH/c17-13-5-4-11(7-14(13)18)15-9-20-16(21-15)12-3-1-2-10(6-12)8-19;/h1-7,9H,8,19H2,(H,20,21);1H |
| InChIKey | ODQHOUIKYVNTFS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride?
The IUPAC name of [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride (CID 70194628) is [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride.
What is the SMILES notation for [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride?
The canonical SMILES for [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride is Cl.NCc1cccc(-c2ncc(-c3ccc(Cl)c(Cl)c3)[nH]2)c1.
What is the InChIKey of [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride?
The InChIKey is ODQHOUIKYVNTFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N3.ClH/c17-13-5-4-11(7-14(13)18)15-9-20-16(21-15)12-3-1-2-10(6-12)8-19;/h1-7,9H,8,19H2,(H,20,21);1H.
What are the key properties of [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride?
[3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride has a molecular weight of 354.67 g/mol, XLogP of 4.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]phenyl]methanamine;hydrochloride is sourced from PubChem (CID 70194628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).