About [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate
[2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate (PubChem CID 70194630) has the molecular formula C17H22F2O5
and a molecular weight of 344.35 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate |
| PubChem CID | 70194630 |
| Molecular Formula | C17H22F2O5 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(OC(=O)C(C)C)C(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H22F2O5/c1-9(2)14(20)23-16(24-15(21)10(3)4)17(5,22)12-7-6-11(18)8-13(12)19/h6-10,16,22H,1-5H3 |
| InChIKey | HMONISUAUBMBOB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate?
The IUPAC name of [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate (CID 70194630) is [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate.
What is the SMILES notation for [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate?
The canonical SMILES for [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate is CC(C)C(=O)OC(OC(=O)C(C)C)C(C)(O)c1ccc(F)cc1F.
What is the InChIKey of [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate?
The InChIKey is HMONISUAUBMBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2O5/c1-9(2)14(20)23-16(24-15(21)10(3)4)17(5,22)12-7-6-11(18)8-13(12)19/h6-10,16,22H,1-5H3.
What are the key properties of [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate?
[2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate has a molecular weight of 344.35 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluorophenyl)-2-hydroxy-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate is sourced from PubChem (CID 70194630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).