C18H20ClF3N2O2 — CID 70194781
(5R)-7-chloro-3-cyclopropyl-5-(3-methylbut-2-enoxy)-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one (PubChem CID 70194781) has the molecular formula C18H20ClF3N2O2 and a molecular weight of 388.82 g/mol. Its IUPAC name is (5R)-7-chloro-3-cyclopropyl-5-(3-methylbut-2-enoxy)-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one.
| Compound Name | (5R)-7-chloro-3-cyclopropyl-5-(3-methylbut-2-enoxy)-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 70194781 |
| Molecular Formula | C18H20ClF3N2O2 |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (5R)-7-chloro-3-cyclopropyl-5-(3-methylbut-2-enoxy)-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one |
| SMILES | CC(C)=CCO[C@@]1(C(F)(F)F)CN(C2CC2)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H20ClF3N2O2/c1-11(2)7-8-26-17(18(20,21)22)10-24(13-4-5-13)16(25)23-15-6-3-12(19)9-14(15)17/h3,6-7,9,13H,4-5,8,10H2,1-2H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | DYMWXORULVOICV-KRWDZBQOSA-N |
| XLogP | 5.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|