About 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine
2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine (PubChem CID 70194801) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine.
Molecular Properties
| Compound Name | 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine |
| PubChem CID | 70194801 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine |
| SMILES | C1=COC(c2ccccc2C2=CCCCC2)=CO1 |
| InChI | InChI=1S/C16H16O2/c1-2-6-13(7-3-1)14-8-4-5-9-15(14)16-12-17-10-11-18-16/h4-6,8-12H,1-3,7H2 |
| InChIKey | YEMLKJICSDRFOS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine?
The IUPAC name of 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine (CID 70194801) is 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine.
What is the SMILES notation for 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine?
The canonical SMILES for 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine is C1=COC(c2ccccc2C2=CCCCC2)=CO1.
What is the InChIKey of 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine?
The InChIKey is YEMLKJICSDRFOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2/c1-2-6-13(7-3-1)14-8-4-5-9-15(14)16-12-17-10-11-18-16/h4-6,8-12H,1-3,7H2.
What are the key properties of 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine?
2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine has a molecular weight of 240.30 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(cyclohexen-1-yl)phenyl]-1,4-dioxine is sourced from PubChem (CID 70194801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).