About 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene
6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene (PubChem CID 70194972) has the molecular formula C13H12FNO3
and a molecular weight of 249.24 g/mol. Its IUPAC name is 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene |
| PubChem CID | 70194972 |
| Molecular Formula | C13H12FNO3 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene |
| SMILES | COC1(F)C=CC(c2ccccc2)C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12FNO3/c1-18-13(14)8-7-11(9-12(13)15(16)17)10-5-3-2-4-6-10/h2-9,11H,1H3 |
| InChIKey | CMINQBSODFERIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene?
The IUPAC name of 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene (CID 70194972) is 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene.
What is the SMILES notation for 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene?
The canonical SMILES for 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene is COC1(F)C=CC(c2ccccc2)C=C1[N+](=O)[O-].
What is the InChIKey of 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene?
The InChIKey is CMINQBSODFERIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO3/c1-18-13(14)8-7-11(9-12(13)15(16)17)10-5-3-2-4-6-10/h2-9,11H,1H3.
What are the key properties of 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene?
6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene has a molecular weight of 249.24 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene is sourced from PubChem (CID 70194972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).