About (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate
(2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate (PubChem CID 7019551) has the molecular formula C8H7F2NO2
and a molecular weight of 187.15 g/mol. Its IUPAC name is (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate.
Molecular Properties
| Compound Name | (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate |
| PubChem CID | 7019551 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate |
| SMILES | [NH3+][C@H](C(=O)[O-])c1cc(F)ccc1F |
| InChI | InChI=1S/C8H7F2NO2/c9-4-1-2-6(10)5(3-4)7(11)8(12)13/h1-3,7H,11H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | FSTDRNWTSCJIRN-ZETCQYMHSA-N |
| XLogP | -1.00 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate?
The IUPAC name of (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate (CID 7019551) is (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate.
What is the SMILES notation for (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate?
The canonical SMILES for (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate is [NH3+][C@H](C(=O)[O-])c1cc(F)ccc1F.
What is the InChIKey of (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate?
The InChIKey is FSTDRNWTSCJIRN-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H7F2NO2/c9-4-1-2-6(10)5(3-4)7(11)8(12)13/h1-3,7H,11H2,(H,12,13)/t7-/m0/s1.
What are the key properties of (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate?
(2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate has a molecular weight of 187.15 g/mol, XLogP of -1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-azaniumyl-2-(2,5-difluorophenyl)acetate is sourced from PubChem (CID 7019551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).