About 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one
7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one (PubChem CID 70196238) has the molecular formula C15H14ClF3N2O2
and a molecular weight of 346.74 g/mol. Its IUPAC name is 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one |
| PubChem CID | 70196238 |
| Molecular Formula | C15H14ClF3N2O2 |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one |
| SMILES | CC=C(CC)OC1(C(F)(F)F)C=NC(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H14ClF3N2O2/c1-3-10(4-2)23-14(15(17,18)19)8-20-13(22)21-12-6-5-9(16)7-11(12)14/h3,5-8H,4H2,1-2H3,(H,21,22) |
| InChIKey | HYOKNMSQNXNVRD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
The IUPAC name of 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one (CID 70196238) is 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one.
What is the SMILES notation for 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
The canonical SMILES for 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one is CC=C(CC)OC1(C(F)(F)F)C=NC(=O)Nc2ccc(Cl)cc21.
What is the InChIKey of 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
The InChIKey is HYOKNMSQNXNVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClF3N2O2/c1-3-10(4-2)23-14(15(17,18)19)8-20-13(22)21-12-6-5-9(16)7-11(12)14/h3,5-8H,4H2,1-2H3,(H,21,22).
What are the key properties of 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one?
7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one has a molecular weight of 346.74 g/mol, XLogP of 5.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-pent-2-en-3-yloxy-5-(trifluoromethyl)-1H-1,3-benzodiazepin-2-one is sourced from PubChem (CID 70196238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).