About [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate
[5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate (PubChem CID 70197109) has the molecular formula C21H22O2S2
and a molecular weight of 370.54 g/mol. Its IUPAC name is [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate.
Molecular Properties
| Compound Name | [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate |
| PubChem CID | 70197109 |
| Molecular Formula | C21H22O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate |
| SMILES | CCC1(CC)CCSc2ccc(C#Cc3ccc(OC(C)=O)s3)cc21 |
| InChI | InChI=1S/C21H22O2S2/c1-4-21(5-2)12-13-24-19-10-7-16(14-18(19)21)6-8-17-9-11-20(25-17)23-15(3)22/h7,9-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | BPZLJRHCKRFDOW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate?
The IUPAC name of [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate (CID 70197109) is [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate.
What is the SMILES notation for [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate?
The canonical SMILES for [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate is CCC1(CC)CCSc2ccc(C#Cc3ccc(OC(C)=O)s3)cc21.
What is the InChIKey of [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate?
The InChIKey is BPZLJRHCKRFDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O2S2/c1-4-21(5-2)12-13-24-19-10-7-16(14-18(19)21)6-8-17-9-11-20(25-17)23-15(3)22/h7,9-11,14H,4-5,12-13H2,1-3H3.
What are the key properties of [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate?
[5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate has a molecular weight of 370.54 g/mol, XLogP of 5.63, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[2-(4,4-diethyl-2,3-dihydrothiochromen-6-yl)ethynyl]thiophen-2-yl] acetate is sourced from PubChem (CID 70197109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).