About (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride
(6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride (PubChem CID 70197605) has the molecular formula C8H15ClN2
and a molecular weight of 174.68 g/mol. Its IUPAC name is (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride.
Molecular Properties
| Compound Name | (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride |
| PubChem CID | 70197605 |
| Molecular Formula | C8H15ClN2 |
| Molecular Weight | 174.68 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride |
| SMILES | CC1(C)C=CC=CC1NN.Cl |
| InChI | InChI=1S/C8H14N2.ClH/c1-8(2)6-4-3-5-7(8)10-9;/h3-7,10H,9H2,1-2H3;1H |
| InChIKey | RWYSXFJGURHXBW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.68 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride?
The IUPAC name of (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride (CID 70197605) is (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride.
What is the SMILES notation for (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride?
The canonical SMILES for (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride is CC1(C)C=CC=CC1NN.Cl.
What is the InChIKey of (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride?
The InChIKey is RWYSXFJGURHXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2.ClH/c1-8(2)6-4-3-5-7(8)10-9;/h3-7,10H,9H2,1-2H3;1H.
What are the key properties of (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride?
(6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride has a molecular weight of 174.68 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6,6-dimethylcyclohexa-2,4-dien-1-yl)hydrazine;hydrochloride is sourced from PubChem (CID 70197605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).