C37H24Br2O3S2 — CID 70197688
(2R)-2-[2,6-dibromo-4-(6-phenyl-1-sulfanylnaphtho[3,2-b][1]benzothiol-11-yl)phenoxy]-3-phenylpropanoic acid (PubChem CID 70197688) has the molecular formula C37H24Br2O3S2 and a molecular weight of 740.54 g/mol. Its IUPAC name is (2R)-2-[2,6-dibromo-4-(6-phenyl-1-sulfanylnaphtho[3,2-b][1]benzothiol-11-yl)phenoxy]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[2,6-dibromo-4-(6-phenyl-1-sulfanylnaphtho[3,2-b][1]benzothiol-11-yl)phenoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70197688 |
| Molecular Formula | C37H24Br2O3S2 |
| Molecular Weight | 740.54 g/mol |
| Exact Mass | 737.95 |
| IUPAC Name | (2R)-2-[2,6-dibromo-4-(6-phenyl-1-sulfanylnaphtho[3,2-b][1]benzothiol-11-yl)phenoxy]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)Oc1c(Br)cc(-c2c3ccccc3c(-c3ccccc3)c3sc4cccc(S)c4c23)cc1Br |
| InChI | InChI=1S/C37H24Br2O3S2/c38-26-19-23(20-27(39)35(26)42-28(37(40)41)18-21-10-3-1-4-11-21)31-24-14-7-8-15-25(24)32(22-12-5-2-6-13-22)36-34(31)33-29(43)16-9-17-30(33)44-36/h1-17,19-20,28,43H,18H2,(H,40,41)/t28-/m1/s1 |
| InChIKey | CMDRIOMSUDOZBZ-MUUNZHRXSA-N |
| XLogP | 11.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.54 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|