C22H25ClFNO6 — CID 70198179
ethyl (E)-4-[2-chloro-5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate (PubChem CID 70198179) has the molecular formula C22H25ClFNO6 and a molecular weight of 453.89 g/mol. Its IUPAC name is ethyl (E)-4-[2-chloro-5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate.
| Compound Name | ethyl (E)-4-[2-chloro-5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate |
|---|---|
| PubChem CID | 70198179 |
| Molecular Formula | C22H25ClFNO6 |
| Molecular Weight | 453.89 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl (E)-4-[2-chloro-5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate |
| SMILES | CCOC(=O)/C=C(\COc1cc(N2C(=O)C3CCCCC3C2=O)c(F)cc1Cl)OCC |
| InChI | InChI=1S/C22H25ClFNO6/c1-3-29-13(9-20(26)30-4-2)12-31-19-11-18(17(24)10-16(19)23)25-21(27)14-7-5-6-8-15(14)22(25)28/h9-11,14-15H,3-8,12H2,1-2H3/b13-9+ |
| InChIKey | GDDZKYWTZKNLKC-UKTHLTGXSA-N |
| XLogP | 4.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|