About [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate
[2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate (PubChem CID 70198597) has the molecular formula C15H16O9
and a molecular weight of 340.28 g/mol. Its IUPAC name is [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate |
| PubChem CID | 70198597 |
| Molecular Formula | C15H16O9 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC12C=CC(O1)C(OC(=O)OC)=C2OC(=O)OC |
| InChI | InChI=1S/C15H16O9/c1-8(2)12(16)21-7-15-6-5-9(24-15)10(22-13(17)19-3)11(15)23-14(18)20-4/h5-6,9H,1,7H2,2-4H3 |
| InChIKey | IEYCQCKMTFLDKI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate?
The IUPAC name of [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate (CID 70198597) is [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate.
What is the SMILES notation for [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate?
The canonical SMILES for [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC12C=CC(O1)C(OC(=O)OC)=C2OC(=O)OC.
What is the InChIKey of [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate?
The InChIKey is IEYCQCKMTFLDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O9/c1-8(2)12(16)21-7-15-6-5-9(24-15)10(22-13(17)19-3)11(15)23-14(18)20-4/h5-6,9H,1,7H2,2-4H3.
What are the key properties of [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate?
[2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate has a molecular weight of 340.28 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(methoxycarbonyloxy)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methyl 2-methylprop-2-enoate is sourced from PubChem (CID 70198597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).