(2S)-2-formamidohexanoic acid

C7H13NO3 — CID 7019931

IUPAC(2S)-2-formamidohexanoic acid
SMILESCCCC[C@H](NC=O)C(=O)O
InChIInChI=1S/C7H13NO3/c1-2-3-4-6(7(10)11)8-5-9/h5-6H,2-4H2,1H3,(H,8,9)(H,10,11)/t6-/m0/s1
InChIKeyIRIJLKLYPXLQSQ-LURJTMIESA-N
MW159.19 g/mol
LogP0.38
Rot. Bonds6

About (2S)-2-formamidohexanoic acid

(2S)-2-formamidohexanoic acid (PubChem CID 7019931) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is (2S)-2-formamidohexanoic acid.

Molecular Properties

Compound Name(2S)-2-formamidohexanoic acid
PubChem CID7019931
Molecular FormulaC7H13NO3
Molecular Weight159.19 g/mol
Exact Mass159.09
IUPAC Name(2S)-2-formamidohexanoic acid
SMILESCCCC[C@H](NC=O)C(=O)O
InChIInChI=1S/C7H13NO3/c1-2-3-4-6(7(10)11)8-5-9/h5-6H,2-4H2,1H3,(H,8,9)(H,10,11)/t6-/m0/s1
InChIKeyIRIJLKLYPXLQSQ-LURJTMIESA-N
XLogP0.38
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.19
LogP ≤ 50.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze (2S)-2-formamidohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-formamidohexanoic acid?
The IUPAC name of (2S)-2-formamidohexanoic acid (CID 7019931) is (2S)-2-formamidohexanoic acid.
What is the SMILES notation for (2S)-2-formamidohexanoic acid?
The canonical SMILES for (2S)-2-formamidohexanoic acid is CCCC[C@H](NC=O)C(=O)O.
What is the InChIKey of (2S)-2-formamidohexanoic acid?
The InChIKey is IRIJLKLYPXLQSQ-LURJTMIESA-N. The full InChI is InChI=1S/C7H13NO3/c1-2-3-4-6(7(10)11)8-5-9/h5-6H,2-4H2,1H3,(H,8,9)(H,10,11)/t6-/m0/s1.
What are the key properties of (2S)-2-formamidohexanoic acid?
(2S)-2-formamidohexanoic acid has a molecular weight of 159.19 g/mol, XLogP of 0.38, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-formamidohexanoic acid is sourced from PubChem (CID 7019931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).