About (2S)-2-formamidohexanoic acid
(2S)-2-formamidohexanoic acid (PubChem CID 7019931) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is (2S)-2-formamidohexanoic acid.
Molecular Properties
| Compound Name | (2S)-2-formamidohexanoic acid |
| PubChem CID | 7019931 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2S)-2-formamidohexanoic acid |
| SMILES | CCCC[C@H](NC=O)C(=O)O |
| InChI | InChI=1S/C7H13NO3/c1-2-3-4-6(7(10)11)8-5-9/h5-6H,2-4H2,1H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | IRIJLKLYPXLQSQ-LURJTMIESA-N |
| XLogP | 0.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-formamidohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-formamidohexanoic acid?
The IUPAC name of (2S)-2-formamidohexanoic acid (CID 7019931) is (2S)-2-formamidohexanoic acid.
What is the SMILES notation for (2S)-2-formamidohexanoic acid?
The canonical SMILES for (2S)-2-formamidohexanoic acid is CCCC[C@H](NC=O)C(=O)O.
What is the InChIKey of (2S)-2-formamidohexanoic acid?
The InChIKey is IRIJLKLYPXLQSQ-LURJTMIESA-N. The full InChI is InChI=1S/C7H13NO3/c1-2-3-4-6(7(10)11)8-5-9/h5-6H,2-4H2,1H3,(H,8,9)(H,10,11)/t6-/m0/s1.
What are the key properties of (2S)-2-formamidohexanoic acid?
(2S)-2-formamidohexanoic acid has a molecular weight of 159.19 g/mol, XLogP of 0.38, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-formamidohexanoic acid is sourced from PubChem (CID 7019931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).