About 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione
1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione (PubChem CID 70199346) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione.
Molecular Properties
| Compound Name | 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione |
| PubChem CID | 70199346 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione |
| SMILES | NC(=O)c1ccc[nH]1.O=C1C=CNC1=O |
| InChI | InChI=1S/C5H6N2O.C4H3NO2/c6-5(8)4-2-1-3-7-4;6-3-1-2-5-4(3)7/h1-3,7H,(H2,6,8);1-2H,(H,5,6,7) |
| InChIKey | LHYUKYCBLKEGEC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione?
The IUPAC name of 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione (CID 70199346) is 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione.
What is the SMILES notation for 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione?
The canonical SMILES for 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione is NC(=O)c1ccc[nH]1.O=C1C=CNC1=O.
What is the InChIKey of 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione?
The InChIKey is LHYUKYCBLKEGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.C4H3NO2/c6-5(8)4-2-1-3-7-4;6-3-1-2-5-4(3)7/h1-3,7H,(H2,6,8);1-2H,(H,5,6,7).
What are the key properties of 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione?
1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione has a molecular weight of 207.19 g/mol, XLogP of -0.69, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2-carboxamide;1H-pyrrole-2,3-dione is sourced from PubChem (CID 70199346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).