About [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate
[1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate (PubChem CID 70199559) has the molecular formula C11H12O8
and a molecular weight of 272.21 g/mol. Its IUPAC name is [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate.
Molecular Properties
| Compound Name | [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate |
| PubChem CID | 70199559 |
| Molecular Formula | C11H12O8 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(OC(=O)OC)C2(CO)C=CC1O2 |
| InChI | InChI=1S/C11H12O8/c1-15-9(13)17-7-6-3-4-11(5-12,19-6)8(7)18-10(14)16-2/h3-4,6,12H,5H2,1-2H3 |
| InChIKey | PEFSAQMYRNAWPV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate?
The IUPAC name of [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate (CID 70199559) is [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate.
What is the SMILES notation for [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate?
The canonical SMILES for [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate is COC(=O)OC1=C(OC(=O)OC)C2(CO)C=CC1O2.
What is the InChIKey of [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate?
The InChIKey is PEFSAQMYRNAWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O8/c1-15-9(13)17-7-6-3-4-11(5-12,19-6)8(7)18-10(14)16-2/h3-4,6,12H,5H2,1-2H3.
What are the key properties of [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate?
[1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate has a molecular weight of 272.21 g/mol, XLogP of 0.46, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(hydroxymethyl)-3-methoxycarbonyloxy-7-oxabicyclo[2.2.1]hepta-2,5-dien-2-yl] methyl carbonate is sourced from PubChem (CID 70199559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).